About 8-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-5-fluoroquinoline
8-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-5-fluoroquinoline (PubChem CID 121497811) has the molecular formula C14H13FN4
and a molecular weight of 256.28 g/mol. Its IUPAC name is 8-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-5-fluoroquinoline.
Molecular Properties
| Compound Name | 8-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-5-fluoroquinoline |
| PubChem CID | 121497811 |
| Molecular Formula | C14H13FN4 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 8-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-5-fluoroquinoline |
| SMILES | CCn1nc(C)nc1-c1ccc(F)c2cccnc12 |
| InChI | InChI=1S/C14H13FN4/c1-3-19-14(17-9(2)18-19)11-6-7-12(15)10-5-4-8-16-13(10)11/h4-8H,3H2,1-2H3 |
| InChIKey | FHQPDFSLOJUSQY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-5-fluoroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-5-fluoroquinoline?
The IUPAC name of 8-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-5-fluoroquinoline (CID 121497811) is 8-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-5-fluoroquinoline.
What is the SMILES notation for 8-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-5-fluoroquinoline?
The canonical SMILES for 8-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-5-fluoroquinoline is CCn1nc(C)nc1-c1ccc(F)c2cccnc12.
What is the InChIKey of 8-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-5-fluoroquinoline?
The InChIKey is FHQPDFSLOJUSQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN4/c1-3-19-14(17-9(2)18-19)11-6-7-12(15)10-5-4-8-16-13(10)11/h4-8H,3H2,1-2H3.
What are the key properties of 8-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-5-fluoroquinoline?
8-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-5-fluoroquinoline has a molecular weight of 256.28 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-ethyl-5-methyl-1,2,4-triazol-3-yl)-5-fluoroquinoline is sourced from PubChem (CID 121497811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).