About 3-[(4-ethyl-1,3-thiazol-2-yl)methyl]-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea
3-[(4-ethyl-1,3-thiazol-2-yl)methyl]-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea (PubChem CID 121498077) has the molecular formula C15H23N5OS
and a molecular weight of 321.45 g/mol. Its IUPAC name is 3-[(4-ethyl-1,3-thiazol-2-yl)methyl]-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea.
Molecular Properties
| Compound Name | 3-[(4-ethyl-1,3-thiazol-2-yl)methyl]-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea |
| PubChem CID | 121498077 |
| Molecular Formula | C15H23N5OS |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 3-[(4-ethyl-1,3-thiazol-2-yl)methyl]-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea |
| SMILES | CCCN(Cc1nccn1C)C(=O)NCc1nc(CC)cs1 |
| InChI | InChI=1S/C15H23N5OS/c1-4-7-20(10-13-16-6-8-19(13)3)15(21)17-9-14-18-12(5-2)11-22-14/h6,8,11H,4-5,7,9-10H2,1-3H3,(H,17,21) |
| InChIKey | IFOHLJXWHVPQJC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(4-ethyl-1,3-thiazol-2-yl)methyl]-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-ethyl-1,3-thiazol-2-yl)methyl]-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea?
The IUPAC name of 3-[(4-ethyl-1,3-thiazol-2-yl)methyl]-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea (CID 121498077) is 3-[(4-ethyl-1,3-thiazol-2-yl)methyl]-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea.
What is the SMILES notation for 3-[(4-ethyl-1,3-thiazol-2-yl)methyl]-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea?
The canonical SMILES for 3-[(4-ethyl-1,3-thiazol-2-yl)methyl]-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea is CCCN(Cc1nccn1C)C(=O)NCc1nc(CC)cs1.
What is the InChIKey of 3-[(4-ethyl-1,3-thiazol-2-yl)methyl]-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea?
The InChIKey is IFOHLJXWHVPQJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N5OS/c1-4-7-20(10-13-16-6-8-19(13)3)15(21)17-9-14-18-12(5-2)11-22-14/h6,8,11H,4-5,7,9-10H2,1-3H3,(H,17,21).
What are the key properties of 3-[(4-ethyl-1,3-thiazol-2-yl)methyl]-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea?
3-[(4-ethyl-1,3-thiazol-2-yl)methyl]-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea has a molecular weight of 321.45 g/mol, XLogP of 2.56, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-ethyl-1,3-thiazol-2-yl)methyl]-1-[(1-methylimidazol-2-yl)methyl]-1-propylurea is sourced from PubChem (CID 121498077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).