C17H25NO4S — CID 121498243
N-(3-hydroxypropyl)-1-(4-methylsulfonylphenyl)cyclohexane-1-carboxamide (PubChem CID 121498243) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-1-(4-methylsulfonylphenyl)cyclohexane-1-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-1-(4-methylsulfonylphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 121498243 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-(3-hydroxypropyl)-1-(4-methylsulfonylphenyl)cyclohexane-1-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(C2(C(=O)NCCCO)CCCCC2)cc1 |
| InChI | InChI=1S/C17H25NO4S/c1-23(21,22)15-8-6-14(7-9-15)17(10-3-2-4-11-17)16(20)18-12-5-13-19/h6-9,19H,2-5,10-13H2,1H3,(H,18,20) |
| InChIKey | VSYYLBCEODWEQF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|