C15H23N3O3 — CID 121498599
N-[2-(butylamino)-2-oxoethyl]-N,2,6-trimethyl-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 121498599) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-[2-(butylamino)-2-oxoethyl]-N,2,6-trimethyl-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[2-(butylamino)-2-oxoethyl]-N,2,6-trimethyl-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121498599 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-[2-(butylamino)-2-oxoethyl]-N,2,6-trimethyl-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCCCNC(=O)CN(C)C(=O)c1c(C)[nH]c(C)cc1=O |
| InChI | InChI=1S/C15H23N3O3/c1-5-6-7-16-13(20)9-18(4)15(21)14-11(3)17-10(2)8-12(14)19/h8H,5-7,9H2,1-4H3,(H,16,20)(H,17,19) |
| InChIKey | UAHBYOSWNSHNDR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|