About 7,8-dimethoxy-1-methyl-3-phenyl-5-thiophen-2-ylpyrazolo[5,4-c]isoquinoline
7,8-dimethoxy-1-methyl-3-phenyl-5-thiophen-2-ylpyrazolo[5,4-c]isoquinoline (PubChem CID 1214989) has the molecular formula C23H19N3O2S
and a molecular weight of 401.49 g/mol. Its IUPAC name is 7,8-dimethoxy-1-methyl-3-phenyl-5-thiophen-2-ylpyrazolo[5,4-c]isoquinoline.
Molecular Properties
| Compound Name | 7,8-dimethoxy-1-methyl-3-phenyl-5-thiophen-2-ylpyrazolo[5,4-c]isoquinoline |
| PubChem CID | 1214989 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 7,8-dimethoxy-1-methyl-3-phenyl-5-thiophen-2-ylpyrazolo[5,4-c]isoquinoline |
| SMILES | COc1cc2c(-c3cccs3)nc3c(c(C)nn3-c3ccccc3)c2cc1OC |
| InChI | InChI=1S/C23H19N3O2S/c1-14-21-16-12-18(27-2)19(28-3)13-17(16)22(20-10-7-11-29-20)24-23(21)26(25-14)15-8-5-4-6-9-15/h4-13H,1-3H3 |
| InChIKey | JJILAGVDBIMJTJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7,8-dimethoxy-1-methyl-3-phenyl-5-thiophen-2-ylpyrazolo[5,4-c]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethoxy-1-methyl-3-phenyl-5-thiophen-2-ylpyrazolo[5,4-c]isoquinoline?
The IUPAC name of 7,8-dimethoxy-1-methyl-3-phenyl-5-thiophen-2-ylpyrazolo[5,4-c]isoquinoline (CID 1214989) is 7,8-dimethoxy-1-methyl-3-phenyl-5-thiophen-2-ylpyrazolo[5,4-c]isoquinoline.
What is the SMILES notation for 7,8-dimethoxy-1-methyl-3-phenyl-5-thiophen-2-ylpyrazolo[5,4-c]isoquinoline?
The canonical SMILES for 7,8-dimethoxy-1-methyl-3-phenyl-5-thiophen-2-ylpyrazolo[5,4-c]isoquinoline is COc1cc2c(-c3cccs3)nc3c(c(C)nn3-c3ccccc3)c2cc1OC.
What is the InChIKey of 7,8-dimethoxy-1-methyl-3-phenyl-5-thiophen-2-ylpyrazolo[5,4-c]isoquinoline?
The InChIKey is JJILAGVDBIMJTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N3O2S/c1-14-21-16-12-18(27-2)19(28-3)13-17(16)22(20-10-7-11-29-20)24-23(21)26(25-14)15-8-5-4-6-9-15/h4-13H,1-3H3.
What are the key properties of 7,8-dimethoxy-1-methyl-3-phenyl-5-thiophen-2-ylpyrazolo[5,4-c]isoquinoline?
7,8-dimethoxy-1-methyl-3-phenyl-5-thiophen-2-ylpyrazolo[5,4-c]isoquinoline has a molecular weight of 401.49 g/mol, XLogP of 5.63, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethoxy-1-methyl-3-phenyl-5-thiophen-2-ylpyrazolo[5,4-c]isoquinoline is sourced from PubChem (CID 1214989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).