About 3-(2,5-dimethylpyrimidin-4-yl)-N,N-dimethylaniline
3-(2,5-dimethylpyrimidin-4-yl)-N,N-dimethylaniline (PubChem CID 121499473) has the molecular formula C14H17N3
and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrimidin-4-yl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 3-(2,5-dimethylpyrimidin-4-yl)-N,N-dimethylaniline |
| PubChem CID | 121499473 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 3-(2,5-dimethylpyrimidin-4-yl)-N,N-dimethylaniline |
| SMILES | Cc1ncc(C)c(-c2cccc(N(C)C)c2)n1 |
| InChI | InChI=1S/C14H17N3/c1-10-9-15-11(2)16-14(10)12-6-5-7-13(8-12)17(3)4/h5-9H,1-4H3 |
| InChIKey | QAIKJEKZNZHZMP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,5-dimethylpyrimidin-4-yl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethylpyrimidin-4-yl)-N,N-dimethylaniline?
The IUPAC name of 3-(2,5-dimethylpyrimidin-4-yl)-N,N-dimethylaniline (CID 121499473) is 3-(2,5-dimethylpyrimidin-4-yl)-N,N-dimethylaniline.
What is the SMILES notation for 3-(2,5-dimethylpyrimidin-4-yl)-N,N-dimethylaniline?
The canonical SMILES for 3-(2,5-dimethylpyrimidin-4-yl)-N,N-dimethylaniline is Cc1ncc(C)c(-c2cccc(N(C)C)c2)n1.
What is the InChIKey of 3-(2,5-dimethylpyrimidin-4-yl)-N,N-dimethylaniline?
The InChIKey is QAIKJEKZNZHZMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3/c1-10-9-15-11(2)16-14(10)12-6-5-7-13(8-12)17(3)4/h5-9H,1-4H3.
What are the key properties of 3-(2,5-dimethylpyrimidin-4-yl)-N,N-dimethylaniline?
3-(2,5-dimethylpyrimidin-4-yl)-N,N-dimethylaniline has a molecular weight of 227.31 g/mol, XLogP of 2.83, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethylpyrimidin-4-yl)-N,N-dimethylaniline is sourced from PubChem (CID 121499473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).