About 5-(3,3-dimethyl-4-phenylpyrrolidin-1-yl)sulfonyl-2-ethyl-1H-imidazole
5-(3,3-dimethyl-4-phenylpyrrolidin-1-yl)sulfonyl-2-ethyl-1H-imidazole (PubChem CID 121499650) has the molecular formula C17H23N3O2S
and a molecular weight of 333.46 g/mol. Its IUPAC name is 5-(3,3-dimethyl-4-phenylpyrrolidin-1-yl)sulfonyl-2-ethyl-1H-imidazole.
Molecular Properties
| Compound Name | 5-(3,3-dimethyl-4-phenylpyrrolidin-1-yl)sulfonyl-2-ethyl-1H-imidazole |
| PubChem CID | 121499650 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 5-(3,3-dimethyl-4-phenylpyrrolidin-1-yl)sulfonyl-2-ethyl-1H-imidazole |
| SMILES | CCc1ncc(S(=O)(=O)N2CC(c3ccccc3)C(C)(C)C2)[nH]1 |
| InChI | InChI=1S/C17H23N3O2S/c1-4-15-18-10-16(19-15)23(21,22)20-11-14(17(2,3)12-20)13-8-6-5-7-9-13/h5-10,14H,4,11-12H2,1-3H3,(H,18,19) |
| InChIKey | SNMUOIDFRGCFSX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3,3-dimethyl-4-phenylpyrrolidin-1-yl)sulfonyl-2-ethyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,3-dimethyl-4-phenylpyrrolidin-1-yl)sulfonyl-2-ethyl-1H-imidazole?
The IUPAC name of 5-(3,3-dimethyl-4-phenylpyrrolidin-1-yl)sulfonyl-2-ethyl-1H-imidazole (CID 121499650) is 5-(3,3-dimethyl-4-phenylpyrrolidin-1-yl)sulfonyl-2-ethyl-1H-imidazole.
What is the SMILES notation for 5-(3,3-dimethyl-4-phenylpyrrolidin-1-yl)sulfonyl-2-ethyl-1H-imidazole?
The canonical SMILES for 5-(3,3-dimethyl-4-phenylpyrrolidin-1-yl)sulfonyl-2-ethyl-1H-imidazole is CCc1ncc(S(=O)(=O)N2CC(c3ccccc3)C(C)(C)C2)[nH]1.
What is the InChIKey of 5-(3,3-dimethyl-4-phenylpyrrolidin-1-yl)sulfonyl-2-ethyl-1H-imidazole?
The InChIKey is SNMUOIDFRGCFSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O2S/c1-4-15-18-10-16(19-15)23(21,22)20-11-14(17(2,3)12-20)13-8-6-5-7-9-13/h5-10,14H,4,11-12H2,1-3H3,(H,18,19).
What are the key properties of 5-(3,3-dimethyl-4-phenylpyrrolidin-1-yl)sulfonyl-2-ethyl-1H-imidazole?
5-(3,3-dimethyl-4-phenylpyrrolidin-1-yl)sulfonyl-2-ethyl-1H-imidazole has a molecular weight of 333.46 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3-dimethyl-4-phenylpyrrolidin-1-yl)sulfonyl-2-ethyl-1H-imidazole is sourced from PubChem (CID 121499650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).