About 3-(1,2-dimethylindolizin-3-yl)-1,2-dimethylindolizine
3-(1,2-dimethylindolizin-3-yl)-1,2-dimethylindolizine (PubChem CID 1215027) has the molecular formula C20H20N2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-(1,2-dimethylindolizin-3-yl)-1,2-dimethylindolizine.
Molecular Properties
| Compound Name | 3-(1,2-dimethylindolizin-3-yl)-1,2-dimethylindolizine |
| PubChem CID | 1215027 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 3-(1,2-dimethylindolizin-3-yl)-1,2-dimethylindolizine |
| SMILES | Cc1c(C)c2ccccn2c1-c1c(C)c(C)c2ccccn12 |
| InChI | InChI=1S/C20H20N2/c1-13-15(3)19(21-11-7-5-9-17(13)21)20-16(4)14(2)18-10-6-8-12-22(18)20/h5-12H,1-4H3 |
| InChIKey | FXYBUBYEOWMNSX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 8.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1,2-dimethylindolizin-3-yl)-1,2-dimethylindolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-dimethylindolizin-3-yl)-1,2-dimethylindolizine?
The IUPAC name of 3-(1,2-dimethylindolizin-3-yl)-1,2-dimethylindolizine (CID 1215027) is 3-(1,2-dimethylindolizin-3-yl)-1,2-dimethylindolizine.
What is the SMILES notation for 3-(1,2-dimethylindolizin-3-yl)-1,2-dimethylindolizine?
The canonical SMILES for 3-(1,2-dimethylindolizin-3-yl)-1,2-dimethylindolizine is Cc1c(C)c2ccccn2c1-c1c(C)c(C)c2ccccn12.
What is the InChIKey of 3-(1,2-dimethylindolizin-3-yl)-1,2-dimethylindolizine?
The InChIKey is FXYBUBYEOWMNSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2/c1-13-15(3)19(21-11-7-5-9-17(13)21)20-16(4)14(2)18-10-6-8-12-22(18)20/h5-12H,1-4H3.
What are the key properties of 3-(1,2-dimethylindolizin-3-yl)-1,2-dimethylindolizine?
3-(1,2-dimethylindolizin-3-yl)-1,2-dimethylindolizine has a molecular weight of 288.39 g/mol, XLogP of 5.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-dimethylindolizin-3-yl)-1,2-dimethylindolizine is sourced from PubChem (CID 1215027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).