About diethyl 4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate
diethyl 4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 1215180) has the molecular formula C17H19NO4
and a molecular weight of 301.34 g/mol. Its IUPAC name is diethyl 4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate |
| PubChem CID | 1215180 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | diethyl 4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CNC=C(C(=O)OCC)C1c1ccccc1 |
| InChI | InChI=1S/C17H19NO4/c1-3-21-16(19)13-10-18-11-14(17(20)22-4-2)15(13)12-8-6-5-7-9-12/h5-11,15,18H,3-4H2,1-2H3 |
| InChIKey | BHWJNHBZNDGSIY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze diethyl 4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate?
The IUPAC name of diethyl 4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate (CID 1215180) is diethyl 4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate.
What is the SMILES notation for diethyl 4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate?
The canonical SMILES for diethyl 4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate is CCOC(=O)C1=CNC=C(C(=O)OCC)C1c1ccccc1.
What is the InChIKey of diethyl 4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate?
The InChIKey is BHWJNHBZNDGSIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO4/c1-3-21-16(19)13-10-18-11-14(17(20)22-4-2)15(13)12-8-6-5-7-9-12/h5-11,15,18H,3-4H2,1-2H3.
What are the key properties of diethyl 4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate?
diethyl 4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate has a molecular weight of 301.34 g/mol, XLogP of 2.27, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-phenyl-1,4-dihydropyridine-3,5-dicarboxylate is sourced from PubChem (CID 1215180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).