About diethyl 1-(3-fluorophenyl)-4-phenyl-4H-pyridine-3,5-dicarboxylate
diethyl 1-(3-fluorophenyl)-4-phenyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 1215183) has the molecular formula C23H22FNO4
and a molecular weight of 395.43 g/mol. Its IUPAC name is diethyl 1-(3-fluorophenyl)-4-phenyl-4H-pyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 1-(3-fluorophenyl)-4-phenyl-4H-pyridine-3,5-dicarboxylate |
| PubChem CID | 1215183 |
| Molecular Formula | C23H22FNO4 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | diethyl 1-(3-fluorophenyl)-4-phenyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CN(c2cccc(F)c2)C=C(C(=O)OCC)C1c1ccccc1 |
| InChI | InChI=1S/C23H22FNO4/c1-3-28-22(26)19-14-25(18-12-8-11-17(24)13-18)15-20(23(27)29-4-2)21(19)16-9-6-5-7-10-16/h5-15,21H,3-4H2,1-2H3 |
| InChIKey | ZWQAHZJJPFKWEK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze diethyl 1-(3-fluorophenyl)-4-phenyl-4H-pyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 1-(3-fluorophenyl)-4-phenyl-4H-pyridine-3,5-dicarboxylate?
The IUPAC name of diethyl 1-(3-fluorophenyl)-4-phenyl-4H-pyridine-3,5-dicarboxylate (CID 1215183) is diethyl 1-(3-fluorophenyl)-4-phenyl-4H-pyridine-3,5-dicarboxylate.
What is the SMILES notation for diethyl 1-(3-fluorophenyl)-4-phenyl-4H-pyridine-3,5-dicarboxylate?
The canonical SMILES for diethyl 1-(3-fluorophenyl)-4-phenyl-4H-pyridine-3,5-dicarboxylate is CCOC(=O)C1=CN(c2cccc(F)c2)C=C(C(=O)OCC)C1c1ccccc1.
What is the InChIKey of diethyl 1-(3-fluorophenyl)-4-phenyl-4H-pyridine-3,5-dicarboxylate?
The InChIKey is ZWQAHZJJPFKWEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22FNO4/c1-3-28-22(26)19-14-25(18-12-8-11-17(24)13-18)15-20(23(27)29-4-2)21(19)16-9-6-5-7-10-16/h5-15,21H,3-4H2,1-2H3.
What are the key properties of diethyl 1-(3-fluorophenyl)-4-phenyl-4H-pyridine-3,5-dicarboxylate?
diethyl 1-(3-fluorophenyl)-4-phenyl-4H-pyridine-3,5-dicarboxylate has a molecular weight of 395.43 g/mol, XLogP of 4.32, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 1-(3-fluorophenyl)-4-phenyl-4H-pyridine-3,5-dicarboxylate is sourced from PubChem (CID 1215183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).