About 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]morpholine
4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]morpholine (PubChem CID 1215255) has the molecular formula C11H19N3O
and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]morpholine.
Molecular Properties
| Compound Name | 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]morpholine |
| PubChem CID | 1215255 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]morpholine |
| SMILES | Cc1n[nH]c(C)c1CCN1CCOCC1 |
| InChI | InChI=1S/C11H19N3O/c1-9-11(10(2)13-12-9)3-4-14-5-7-15-8-6-14/h3-8H2,1-2H3,(H,12,13) |
| InChIKey | VIKAMQNWLXTIFK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]morpholine?
The IUPAC name of 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]morpholine (CID 1215255) is 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]morpholine.
What is the SMILES notation for 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]morpholine?
The canonical SMILES for 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]morpholine is Cc1n[nH]c(C)c1CCN1CCOCC1.
What is the InChIKey of 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]morpholine?
The InChIKey is VIKAMQNWLXTIFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O/c1-9-11(10(2)13-12-9)3-4-14-5-7-15-8-6-14/h3-8H2,1-2H3,(H,12,13).
What are the key properties of 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]morpholine?
4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]morpholine has a molecular weight of 209.29 g/mol, XLogP of 0.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]morpholine is sourced from PubChem (CID 1215255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).