C21H30O5 — CID 12157726
methyl (1'R,3'R,3'aS,6'aR)-5,5-dimethyl-2'-oxo-1',3'-bis(prop-2-enyl)spiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate (PubChem CID 12157726) has the molecular formula C21H30O5 and a molecular weight of 362.50 g/mol. Its IUPAC name is methyl (1'R,3'R,3'aS,6'aR)-5,5-dimethyl-2'-oxo-1',3'-bis(prop-2-enyl)spiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate.
| Compound Name | methyl (1'R,3'R,3'aS,6'aR)-5,5-dimethyl-2'-oxo-1',3'-bis(prop-2-enyl)spiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate |
|---|---|
| PubChem CID | 12157726 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | methyl (1'R,3'R,3'aS,6'aR)-5,5-dimethyl-2'-oxo-1',3'-bis(prop-2-enyl)spiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate |
| SMILES | CC1(COC2(C[C@H]3[C@@H](C2)[C@@](C(=O)[C@@H]3CC=C)(CC=C)C(=O)OC)OC1)C |
| InChI | InChI=1S/C21H30O5/c1-6-8-14-15-10-20(25-12-19(3,4)13-26-20)11-16(15)21(9-7-2,17(14)22)18(23)24-5/h6-7,14-16H,1-2,8-13H2,3-5H3/t14-,15-,16-,21-/m1/s1 |
| InChIKey | HKCAUJQNRGWWFS-WSOZGMELSA-N |
| XLogP | 3.50 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | 612 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|