About Galantamine Hydrobromide
Galantamine Hydrobromide (PubChem CID 121587) has the molecular formula C17H22BrNO3
and a molecular weight of 368.30 g/mol. Its IUPAC name is (1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol;hydrobromide.
Molecular Properties
| Compound Name | Galantamine Hydrobromide |
| PubChem CID | 121587 |
| Molecular Formula | C17H22BrNO3 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol;hydrobromide |
| SMILES | CN1CC[C@@]23C=C[C@@H](C[C@@H]2OC4=C(C=CC(=C34)C1)OC)O.Br |
| InChI | InChI=1S/C17H21NO3.BrH/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17;/h3-6,12,14,19H,7-10H2,1-2H3;1H/t12-,14-,17-;/m0./s1 |
| InChIKey | QORVDGQLPPAFRS-XPSHAMGMSA-N |
| XLogP | — |
| TPSA | 41.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | 440 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Galantamine Hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Galantamine Hydrobromide?
The IUPAC name of Galantamine Hydrobromide (CID 121587) is (1S,12S,14R)-9-methoxy-4-methyl-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol;hydrobromide.
What is the SMILES notation for Galantamine Hydrobromide?
The canonical SMILES for Galantamine Hydrobromide is CN1CC[C@@]23C=C[C@@H](C[C@@H]2OC4=C(C=CC(=C34)C1)OC)O.Br.
What is the InChIKey of Galantamine Hydrobromide?
The InChIKey is QORVDGQLPPAFRS-XPSHAMGMSA-N. The full InChI is InChI=1S/C17H21NO3.BrH/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17;/h3-6,12,14,19H,7-10H2,1-2H3;1H/t12-,14-,17-;/m0./s1.
What are the key properties of Galantamine Hydrobromide?
Galantamine Hydrobromide has a molecular weight of 368.30 g/mol, XLogP of not available, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Galantamine Hydrobromide is sourced from PubChem (CID 121587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).