About 8-(4-methylphenyl)-7,9-dioxa-1-thia-3-azaspiro[4.5]decane-2,4-dione
8-(4-methylphenyl)-7,9-dioxa-1-thia-3-azaspiro[4.5]decane-2,4-dione (PubChem CID 1216099) has the molecular formula C13H13NO4S
and a molecular weight of 279.32 g/mol. Its IUPAC name is 8-(4-methylphenyl)-7,9-dioxa-1-thia-3-azaspiro[4.5]decane-2,4-dione.
Molecular Properties
| Compound Name | 8-(4-methylphenyl)-7,9-dioxa-1-thia-3-azaspiro[4.5]decane-2,4-dione |
| PubChem CID | 1216099 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 8-(4-methylphenyl)-7,9-dioxa-1-thia-3-azaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1ccc(C2OCC3(CO2)SC(=O)NC3=O)cc1 |
| InChI | InChI=1S/C13H13NO4S/c1-8-2-4-9(5-3-8)10-17-6-13(7-18-10)11(15)14-12(16)19-13/h2-5,10H,6-7H2,1H3,(H,14,15,16) |
| InChIKey | BTNGLSUCHZLBNS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 8-(4-methylphenyl)-7,9-dioxa-1-thia-3-azaspiro[4.5]decane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-methylphenyl)-7,9-dioxa-1-thia-3-azaspiro[4.5]decane-2,4-dione?
The IUPAC name of 8-(4-methylphenyl)-7,9-dioxa-1-thia-3-azaspiro[4.5]decane-2,4-dione (CID 1216099) is 8-(4-methylphenyl)-7,9-dioxa-1-thia-3-azaspiro[4.5]decane-2,4-dione.
What is the SMILES notation for 8-(4-methylphenyl)-7,9-dioxa-1-thia-3-azaspiro[4.5]decane-2,4-dione?
The canonical SMILES for 8-(4-methylphenyl)-7,9-dioxa-1-thia-3-azaspiro[4.5]decane-2,4-dione is Cc1ccc(C2OCC3(CO2)SC(=O)NC3=O)cc1.
What is the InChIKey of 8-(4-methylphenyl)-7,9-dioxa-1-thia-3-azaspiro[4.5]decane-2,4-dione?
The InChIKey is BTNGLSUCHZLBNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4S/c1-8-2-4-9(5-3-8)10-17-6-13(7-18-10)11(15)14-12(16)19-13/h2-5,10H,6-7H2,1H3,(H,14,15,16).
What are the key properties of 8-(4-methylphenyl)-7,9-dioxa-1-thia-3-azaspiro[4.5]decane-2,4-dione?
8-(4-methylphenyl)-7,9-dioxa-1-thia-3-azaspiro[4.5]decane-2,4-dione has a molecular weight of 279.32 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-methylphenyl)-7,9-dioxa-1-thia-3-azaspiro[4.5]decane-2,4-dione is sourced from PubChem (CID 1216099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).