About (2R,6S)-4-(4-methylphenyl)sulfonyl-2,6-diphenylmorpholine
(2R,6S)-4-(4-methylphenyl)sulfonyl-2,6-diphenylmorpholine (PubChem CID 1216322) has the molecular formula C23H23NO3S
and a molecular weight of 393.51 g/mol. Its IUPAC name is (2R,6S)-4-(4-methylphenyl)sulfonyl-2,6-diphenylmorpholine.
Molecular Properties
| Compound Name | (2R,6S)-4-(4-methylphenyl)sulfonyl-2,6-diphenylmorpholine |
| PubChem CID | 1216322 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (2R,6S)-4-(4-methylphenyl)sulfonyl-2,6-diphenylmorpholine |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](c3ccccc3)O[C@@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C23H23NO3S/c1-18-12-14-21(15-13-18)28(25,26)24-16-22(19-8-4-2-5-9-19)27-23(17-24)20-10-6-3-7-11-20/h2-15,22-23H,16-17H2,1H3/t22-,23+ |
| InChIKey | CBVBEOQFUIWJPN-ZRZAMGCNSA-N |
| XLogP | 4.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,6S)-4-(4-methylphenyl)sulfonyl-2,6-diphenylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-4-(4-methylphenyl)sulfonyl-2,6-diphenylmorpholine?
The IUPAC name of (2R,6S)-4-(4-methylphenyl)sulfonyl-2,6-diphenylmorpholine (CID 1216322) is (2R,6S)-4-(4-methylphenyl)sulfonyl-2,6-diphenylmorpholine.
What is the SMILES notation for (2R,6S)-4-(4-methylphenyl)sulfonyl-2,6-diphenylmorpholine?
The canonical SMILES for (2R,6S)-4-(4-methylphenyl)sulfonyl-2,6-diphenylmorpholine is Cc1ccc(S(=O)(=O)N2C[C@@H](c3ccccc3)O[C@@H](c3ccccc3)C2)cc1.
What is the InChIKey of (2R,6S)-4-(4-methylphenyl)sulfonyl-2,6-diphenylmorpholine?
The InChIKey is CBVBEOQFUIWJPN-ZRZAMGCNSA-N. The full InChI is InChI=1S/C23H23NO3S/c1-18-12-14-21(15-13-18)28(25,26)24-16-22(19-8-4-2-5-9-19)27-23(17-24)20-10-6-3-7-11-20/h2-15,22-23H,16-17H2,1H3/t22-,23+.
What are the key properties of (2R,6S)-4-(4-methylphenyl)sulfonyl-2,6-diphenylmorpholine?
(2R,6S)-4-(4-methylphenyl)sulfonyl-2,6-diphenylmorpholine has a molecular weight of 393.51 g/mol, XLogP of 4.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-4-(4-methylphenyl)sulfonyl-2,6-diphenylmorpholine is sourced from PubChem (CID 1216322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).