About 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid
2-[(2,4-dichloro-5-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid (PubChem CID 1216381) has the molecular formula C19H18Cl2N2O5S
and a molecular weight of 457.34 g/mol. Its IUPAC name is 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid.
Molecular Properties
| Compound Name | 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid |
| PubChem CID | 1216381 |
| Molecular Formula | C19H18Cl2N2O5S |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)c1cc(S(=O)(=O)N2CCCCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H18Cl2N2O5S/c20-14-11-15(21)17(29(27,28)23-8-4-1-5-9-23)10-13(14)18(24)22-16-7-3-2-6-12(16)19(25)26/h2-3,6-7,10-11H,1,4-5,8-9H2,(H,22,24)(H,25,26) |
| InChIKey | HPKFLDUBRVXTRT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid?
The IUPAC name of 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid (CID 1216381) is 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid.
What is the SMILES notation for 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid?
The canonical SMILES for 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid is O=C(Nc1ccccc1C(=O)O)c1cc(S(=O)(=O)N2CCCCC2)c(Cl)cc1Cl.
What is the InChIKey of 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid?
The InChIKey is HPKFLDUBRVXTRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18Cl2N2O5S/c20-14-11-15(21)17(29(27,28)23-8-4-1-5-9-23)10-13(14)18(24)22-16-7-3-2-6-12(16)19(25)26/h2-3,6-7,10-11H,1,4-5,8-9H2,(H,22,24)(H,25,26).
What are the key properties of 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid?
2-[(2,4-dichloro-5-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid has a molecular weight of 457.34 g/mol, XLogP of 4.12, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dichloro-5-piperidin-1-ylsulfonylbenzoyl)amino]benzoic acid is sourced from PubChem (CID 1216381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).