About N-(3,4-dimethylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide
N-(3,4-dimethylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide (PubChem CID 1216527) has the molecular formula C22H18N2OS
and a molecular weight of 358.47 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide.
Molecular Properties
| Compound Name | N-(3,4-dimethylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide |
| PubChem CID | 1216527 |
| Molecular Formula | C22H18N2OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(-c3cccs3)nc3ccccc23)cc1C |
| InChI | InChI=1S/C22H18N2OS/c1-14-9-10-16(12-15(14)2)23-22(25)18-13-20(21-8-5-11-26-21)24-19-7-4-3-6-17(18)19/h3-13H,1-2H3,(H,23,25) |
| InChIKey | HXOIEJGMQPKDFK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,4-dimethylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide?
The IUPAC name of N-(3,4-dimethylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide (CID 1216527) is N-(3,4-dimethylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide.
What is the SMILES notation for N-(3,4-dimethylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide?
The canonical SMILES for N-(3,4-dimethylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide is Cc1ccc(NC(=O)c2cc(-c3cccs3)nc3ccccc23)cc1C.
What is the InChIKey of N-(3,4-dimethylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide?
The InChIKey is HXOIEJGMQPKDFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2OS/c1-14-9-10-16(12-15(14)2)23-22(25)18-13-20(21-8-5-11-26-21)24-19-7-4-3-6-17(18)19/h3-13H,1-2H3,(H,23,25).
What are the key properties of N-(3,4-dimethylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide?
N-(3,4-dimethylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide has a molecular weight of 358.47 g/mol, XLogP of 5.83, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethylphenyl)-2-thiophen-2-ylquinoline-4-carboxamide is sourced from PubChem (CID 1216527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).