C12H22OSi — CID 12169600
(1R,3aS,6E,6aR)-6-(trimethylsilylmethylidene)-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-ol (PubChem CID 12169600) has the molecular formula C12H22OSi and a molecular weight of 210.39 g/mol. Its IUPAC name is (1R,3aS,6E,6aR)-6-(trimethylsilylmethylidene)-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-ol.
| Compound Name | (1R,3aS,6E,6aR)-6-(trimethylsilylmethylidene)-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-ol |
|---|---|
| PubChem CID | 12169600 |
| Molecular Formula | C12H22OSi |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (1R,3aS,6E,6aR)-6-(trimethylsilylmethylidene)-2,3,3a,4,5,6a-hexahydro-1H-pentalen-1-ol |
| SMILES | C[Si](C)(C)/C=C/1\CC[C@@H]2[C@H]1[C@@H](CC2)O |
| InChI | InChI=1S/C12H22OSi/c1-14(2,3)8-10-5-4-9-6-7-11(13)12(9)10/h8-9,11-13H,4-7H2,1-3H3/b10-8+/t9-,11+,12+/m0/s1 |
| InChIKey | PQUXXYUJFNLGHJ-RRUJWPSXSA-N |
| XLogP | — |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | 252 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|