C25H27NO3 — CID 1217318
[2-oxo-2-(2,3,5,6-tetramethylphenyl)ethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate (PubChem CID 1217318) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is [2-oxo-2-(2,3,5,6-tetramethylphenyl)ethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate.
| Compound Name | [2-oxo-2-(2,3,5,6-tetramethylphenyl)ethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 1217318 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | [2-oxo-2-(2,3,5,6-tetramethylphenyl)ethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate |
| SMILES | Cc1cc(C)c(C)c(C(=O)COC(=O)c2ccc(-n3c(C)ccc3C)cc2)c1C |
| InChI | InChI=1S/C25H27NO3/c1-15-13-16(2)20(6)24(19(15)5)23(27)14-29-25(28)21-9-11-22(12-10-21)26-17(3)7-8-18(26)4/h7-13H,14H2,1-6H3 |
| InChIKey | XRIYGJVFVIRHAW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|