About 2-(3,4-dicyanophenyl)-3-phenylquinoxaline-6,7-dicarbonitrile
2-(3,4-dicyanophenyl)-3-phenylquinoxaline-6,7-dicarbonitrile (PubChem CID 1217579) has the molecular formula C24H10N6
and a molecular weight of 382.39 g/mol. Its IUPAC name is 2-(3,4-dicyanophenyl)-3-phenylquinoxaline-6,7-dicarbonitrile.
Molecular Properties
| Compound Name | 2-(3,4-dicyanophenyl)-3-phenylquinoxaline-6,7-dicarbonitrile |
| PubChem CID | 1217579 |
| Molecular Formula | C24H10N6 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2-(3,4-dicyanophenyl)-3-phenylquinoxaline-6,7-dicarbonitrile |
| SMILES | N#Cc1ccc(-c2nc3cc(C#N)c(C#N)cc3nc2-c2ccccc2)cc1C#N |
| InChI | InChI=1S/C24H10N6/c25-11-17-7-6-16(8-18(17)12-26)24-23(15-4-2-1-3-5-15)29-21-9-19(13-27)20(14-28)10-22(21)30-24/h1-10H |
| InChIKey | ARJWZNCNXWRXKN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 120.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3,4-dicyanophenyl)-3-phenylquinoxaline-6,7-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dicyanophenyl)-3-phenylquinoxaline-6,7-dicarbonitrile?
The IUPAC name of 2-(3,4-dicyanophenyl)-3-phenylquinoxaline-6,7-dicarbonitrile (CID 1217579) is 2-(3,4-dicyanophenyl)-3-phenylquinoxaline-6,7-dicarbonitrile.
What is the SMILES notation for 2-(3,4-dicyanophenyl)-3-phenylquinoxaline-6,7-dicarbonitrile?
The canonical SMILES for 2-(3,4-dicyanophenyl)-3-phenylquinoxaline-6,7-dicarbonitrile is N#Cc1ccc(-c2nc3cc(C#N)c(C#N)cc3nc2-c2ccccc2)cc1C#N.
What is the InChIKey of 2-(3,4-dicyanophenyl)-3-phenylquinoxaline-6,7-dicarbonitrile?
The InChIKey is ARJWZNCNXWRXKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H10N6/c25-11-17-7-6-16(8-18(17)12-26)24-23(15-4-2-1-3-5-15)29-21-9-19(13-27)20(14-28)10-22(21)30-24/h1-10H.
What are the key properties of 2-(3,4-dicyanophenyl)-3-phenylquinoxaline-6,7-dicarbonitrile?
2-(3,4-dicyanophenyl)-3-phenylquinoxaline-6,7-dicarbonitrile has a molecular weight of 382.39 g/mol, XLogP of 4.45, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dicyanophenyl)-3-phenylquinoxaline-6,7-dicarbonitrile is sourced from PubChem (CID 1217579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).