C23H16Cl2N2O4 — CID 1217628
(2R)-N-[4-(2,4-dichlorophenoxy)phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 1217628) has the molecular formula C23H16Cl2N2O4 and a molecular weight of 455.30 g/mol. Its IUPAC name is (2R)-N-[4-(2,4-dichlorophenoxy)phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | (2R)-N-[4-(2,4-dichlorophenoxy)phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 1217628 |
| Molecular Formula | C23H16Cl2N2O4 |
| Molecular Weight | 455.30 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | (2R)-N-[4-(2,4-dichlorophenoxy)phenyl]-2-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(Oc2ccc(Cl)cc2Cl)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H16Cl2N2O4/c1-13(27-22(29)17-4-2-3-5-18(17)23(27)30)21(28)26-15-7-9-16(10-8-15)31-20-11-6-14(24)12-19(20)25/h2-13H,1H3,(H,26,28)/t13-/m1/s1 |
| InChIKey | IAAWKHLYOMZBBT-CYBMUJFWSA-N |
| XLogP | 5.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.30 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|