C23H20BrNO3 — CID 1218497
4-bromo-N-[3-[2-(3,4-dimethylphenyl)-2-oxoethoxy]phenyl]benzamide (PubChem CID 1218497) has the molecular formula C23H20BrNO3 and a molecular weight of 438.32 g/mol. Its IUPAC name is 4-bromo-N-[3-[2-(3,4-dimethylphenyl)-2-oxoethoxy]phenyl]benzamide.
| Compound Name | 4-bromo-N-[3-[2-(3,4-dimethylphenyl)-2-oxoethoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 1218497 |
| Molecular Formula | C23H20BrNO3 |
| Molecular Weight | 438.32 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 4-bromo-N-[3-[2-(3,4-dimethylphenyl)-2-oxoethoxy]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)COc2cccc(NC(=O)c3ccc(Br)cc3)c2)cc1C |
| InChI | InChI=1S/C23H20BrNO3/c1-15-6-7-18(12-16(15)2)22(26)14-28-21-5-3-4-20(13-21)25-23(27)17-8-10-19(24)11-9-17/h3-13H,14H2,1-2H3,(H,25,27) |
| InChIKey | NAZVWGSZDRQLQV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.32 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |