About [2-(3-chlorophenyl)-3,6,8-trimethylquinolin-4-yl]-morpholin-4-ylmethanone
[2-(3-chlorophenyl)-3,6,8-trimethylquinolin-4-yl]-morpholin-4-ylmethanone (PubChem CID 1218682) has the molecular formula C23H23ClN2O2
and a molecular weight of 394.90 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-3,6,8-trimethylquinolin-4-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [2-(3-chlorophenyl)-3,6,8-trimethylquinolin-4-yl]-morpholin-4-ylmethanone |
| PubChem CID | 1218682 |
| Molecular Formula | C23H23ClN2O2 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [2-(3-chlorophenyl)-3,6,8-trimethylquinolin-4-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1cc(C)c2nc(-c3cccc(Cl)c3)c(C)c(C(=O)N3CCOCC3)c2c1 |
| InChI | InChI=1S/C23H23ClN2O2/c1-14-11-15(2)21-19(12-14)20(23(27)26-7-9-28-10-8-26)16(3)22(25-21)17-5-4-6-18(24)13-17/h4-6,11-13H,7-10H2,1-3H3 |
| InChIKey | MUTLVPOQDNOFDT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(3-chlorophenyl)-3,6,8-trimethylquinolin-4-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-chlorophenyl)-3,6,8-trimethylquinolin-4-yl]-morpholin-4-ylmethanone?
The IUPAC name of [2-(3-chlorophenyl)-3,6,8-trimethylquinolin-4-yl]-morpholin-4-ylmethanone (CID 1218682) is [2-(3-chlorophenyl)-3,6,8-trimethylquinolin-4-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [2-(3-chlorophenyl)-3,6,8-trimethylquinolin-4-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [2-(3-chlorophenyl)-3,6,8-trimethylquinolin-4-yl]-morpholin-4-ylmethanone is Cc1cc(C)c2nc(-c3cccc(Cl)c3)c(C)c(C(=O)N3CCOCC3)c2c1.
What is the InChIKey of [2-(3-chlorophenyl)-3,6,8-trimethylquinolin-4-yl]-morpholin-4-ylmethanone?
The InChIKey is MUTLVPOQDNOFDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23ClN2O2/c1-14-11-15(2)21-19(12-14)20(23(27)26-7-9-28-10-8-26)16(3)22(25-21)17-5-4-6-18(24)13-17/h4-6,11-13H,7-10H2,1-3H3.
What are the key properties of [2-(3-chlorophenyl)-3,6,8-trimethylquinolin-4-yl]-morpholin-4-ylmethanone?
[2-(3-chlorophenyl)-3,6,8-trimethylquinolin-4-yl]-morpholin-4-ylmethanone has a molecular weight of 394.90 g/mol, XLogP of 4.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-chlorophenyl)-3,6,8-trimethylquinolin-4-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 1218682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).