C20H21NO3 — CID 1218876
(4-ethylphenyl) (3R)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 1218876) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (4-ethylphenyl) (3R)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (4-ethylphenyl) (3R)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 1218876 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (4-ethylphenyl) (3R)-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCc1ccc(OC(=O)[C@@H]2CC(=O)N(c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C20H21NO3/c1-3-15-6-10-18(11-7-15)24-20(23)16-12-19(22)21(13-16)17-8-4-14(2)5-9-17/h4-11,16H,3,12-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | BNLNVHRZTMRHNS-MRXNPFEDSA-N |
| XLogP | 3.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|