About but-2-enoyl but-2-enoate
but-2-enoyl but-2-enoate (PubChem CID 12189) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is but-2-enoyl but-2-enoate.
Molecular Properties
| Compound Name | but-2-enoyl but-2-enoate |
| PubChem CID | 12189 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | but-2-enoyl but-2-enoate |
| SMILES | CC=CC(=O)OC(=O)C=CC |
| InChI | InChI=1S/C8H10O3/c1-3-5-7(9)11-8(10)6-4-2/h3-6H,1-2H3 |
| InChIKey | VJDDQSBNUHLBTD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enoyl but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enoyl but-2-enoate?
The IUPAC name of but-2-enoyl but-2-enoate (CID 12189) is but-2-enoyl but-2-enoate.
What is the SMILES notation for but-2-enoyl but-2-enoate?
The canonical SMILES for but-2-enoyl but-2-enoate is CC=CC(=O)OC(=O)C=CC.
What is the InChIKey of but-2-enoyl but-2-enoate?
The InChIKey is VJDDQSBNUHLBTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3/c1-3-5-7(9)11-8(10)6-4-2/h3-6H,1-2H3.
What are the key properties of but-2-enoyl but-2-enoate?
but-2-enoyl but-2-enoate has a molecular weight of 154.16 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enoyl but-2-enoate is sourced from PubChem (CID 12189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).