C23H24Cl2O3 — CID 1218950
9-(3,4-dichlorophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 1218950) has the molecular formula C23H24Cl2O3 and a molecular weight of 419.35 g/mol. Its IUPAC name is 9-(3,4-dichlorophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-(3,4-dichlorophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 1218950 |
| Molecular Formula | C23H24Cl2O3 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 9-(3,4-dichlorophenyl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1=C(C(=O)CC(C)(C)C1)C2c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H24Cl2O3/c1-22(2)8-15(26)20-17(10-22)28-18-11-23(3,4)9-16(27)21(18)19(20)12-5-6-13(24)14(25)7-12/h5-7,19H,8-11H2,1-4H3 |
| InChIKey | YTMOASQGPNBYQS-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |