About 2-Methyl-1,2,3,4-tetrahydro-beta-carboline
2-Methyl-1,2,3,4-tetrahydro-beta-carboline (PubChem CID 121896) has the molecular formula C12H14N2
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 2-Methyl-1,2,3,4-tetrahydro-beta-carboline |
| PubChem CID | 121896 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CN1CCC2=C(C1)NC3=CC=CC=C23 |
| InChI | InChI=1S/C12H14N2/c1-14-7-6-10-9-4-2-3-5-11(9)13-12(10)8-14/h2-5,13H,6-8H2,1H3 |
| InChIKey | JOFKCNJIUXPJAC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 19.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | 216 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2-Methyl-1,2,3,4-tetrahydro-beta-carboline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Methyl-1,2,3,4-tetrahydro-beta-carboline?
The IUPAC name of 2-Methyl-1,2,3,4-tetrahydro-beta-carboline (CID 121896) is 2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
What is the SMILES notation for 2-Methyl-1,2,3,4-tetrahydro-beta-carboline?
The canonical SMILES for 2-Methyl-1,2,3,4-tetrahydro-beta-carboline is CN1CCC2=C(C1)NC3=CC=CC=C23.
What is the InChIKey of 2-Methyl-1,2,3,4-tetrahydro-beta-carboline?
The InChIKey is JOFKCNJIUXPJAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-14-7-6-10-9-4-2-3-5-11(9)13-12(10)8-14/h2-5,13H,6-8H2,1H3.
What are the key properties of 2-Methyl-1,2,3,4-tetrahydro-beta-carboline?
2-Methyl-1,2,3,4-tetrahydro-beta-carboline has a molecular weight of 186.25 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Methyl-1,2,3,4-tetrahydro-beta-carboline is sourced from PubChem (CID 121896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).