C23H21N5O4 — CID 1219136
2-N,5-N-bis(3-acetamidophenyl)pyridine-2,5-dicarboxamide (PubChem CID 1219136) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-N,5-N-bis(3-acetamidophenyl)pyridine-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis(3-acetamidophenyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 1219136 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 2-N,5-N-bis(3-acetamidophenyl)pyridine-2,5-dicarboxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)c2ccc(C(=O)Nc3cccc(NC(C)=O)c3)nc2)c1 |
| InChI | InChI=1S/C23H21N5O4/c1-14(29)25-17-5-3-7-19(11-17)27-22(31)16-9-10-21(24-13-16)23(32)28-20-8-4-6-18(12-20)26-15(2)30/h3-13H,1-2H3,(H,25,29)(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | AYCJLSPBVOOWHU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |