C22H21N5O2 — CID 1219408
(4S,4aR)-2-amino-4-(2,4,6-trimethyl-3-nitrophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 1219408) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is (4S,4aR)-2-amino-4-(2,4,6-trimethyl-3-nitrophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | (4S,4aR)-2-amino-4-(2,4,6-trimethyl-3-nitrophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 1219408 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (4S,4aR)-2-amino-4-(2,4,6-trimethyl-3-nitrophenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | Cc1cc(C)c([N+](=O)[O-])c(C)c1[C@@H]1[C@H]2CCCC=C2C(C#N)=C(N)C1(C#N)C#N |
| InChI | InChI=1S/C22H21N5O2/c1-12-8-13(2)20(27(28)29)14(3)18(12)19-16-7-5-4-6-15(16)17(9-23)21(26)22(19,10-24)11-25/h6,8,16,19H,4-5,7,26H2,1-3H3/t16-,19-/m0/s1 |
| InChIKey | LRTDULZLVQAQPA-LPHOPBHVSA-N |
| XLogP | 4.11 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|