C21H26N2O4 — CID 122000527
3-[methyl-[1-[4-[(3-methylphenyl)methoxy]phenyl]ethylcarbamoyl]amino]propanoic acid (PubChem CID 122000527) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-[methyl-[1-[4-[(3-methylphenyl)methoxy]phenyl]ethylcarbamoyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[1-[4-[(3-methylphenyl)methoxy]phenyl]ethylcarbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122000527 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3-[methyl-[1-[4-[(3-methylphenyl)methoxy]phenyl]ethylcarbamoyl]amino]propanoic acid |
| SMILES | Cc1cccc(COc2ccc(C(C)NC(=O)N(C)CCC(=O)O)cc2)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-15-5-4-6-17(13-15)14-27-19-9-7-18(8-10-19)16(2)22-21(26)23(3)12-11-20(24)25/h4-10,13,16H,11-12,14H2,1-3H3,(H,22,26)(H,24,25) |
| InChIKey | SCQFBHPNPPMDHA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |