C18H33N3O3 — CID 122000847
2-[ethyl-[3-[(3-propan-2-ylcyclohexyl)carbamoylamino]cyclobutyl]amino]acetic acid (PubChem CID 122000847) has the molecular formula C18H33N3O3 and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-[ethyl-[3-[(3-propan-2-ylcyclohexyl)carbamoylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[(3-propan-2-ylcyclohexyl)carbamoylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122000847 |
| Molecular Formula | C18H33N3O3 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.25 |
| IUPAC Name | 2-[ethyl-[3-[(3-propan-2-ylcyclohexyl)carbamoylamino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)NC2CCCC(C(C)C)C2)C1 |
| InChI | InChI=1S/C18H33N3O3/c1-4-21(11-17(22)23)16-9-15(10-16)20-18(24)19-14-7-5-6-13(8-14)12(2)3/h12-16H,4-11H2,1-3H3,(H,22,23)(H2,19,20,24) |
| InChIKey | AXKFFQLACAIGCF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |