C20H22N2O3S — CID 122001277
1-[(2-phenylsulfanylphenyl)methylcarbamoyl]piperidine-4-carboxylic acid (PubChem CID 122001277) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is 1-[(2-phenylsulfanylphenyl)methylcarbamoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(2-phenylsulfanylphenyl)methylcarbamoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 122001277 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[(2-phenylsulfanylphenyl)methylcarbamoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)NCc2ccccc2Sc2ccccc2)CC1 |
| InChI | InChI=1S/C20H22N2O3S/c23-19(24)15-10-12-22(13-11-15)20(25)21-14-16-6-4-5-9-18(16)26-17-7-2-1-3-8-17/h1-9,15H,10-14H2,(H,21,25)(H,23,24) |
| InChIKey | ADCGQUOEXJXXEX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |