C15H19N3O4 — CID 122002288
3-[(2-oxo-1-phenylpiperidin-3-yl)carbamoylamino]propanoic acid (PubChem CID 122002288) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is 3-[(2-oxo-1-phenylpiperidin-3-yl)carbamoylamino]propanoic acid.
| Compound Name | 3-[(2-oxo-1-phenylpiperidin-3-yl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 122002288 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-[(2-oxo-1-phenylpiperidin-3-yl)carbamoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)NC1CCCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C15H19N3O4/c19-13(20)8-9-16-15(22)17-12-7-4-10-18(14(12)21)11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,19,20)(H2,16,17,22) |
| InChIKey | ZRZQRGYGXXGWRT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |