C17H21N5O3 — CID 122002366
4-[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)carbamoylamino]methyl]benzoic acid (PubChem CID 122002366) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 4-[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)carbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)carbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122002366 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 4-[[(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)carbamoylamino]methyl]benzoic acid |
| SMILES | CCc1nc2n(n1)CC(NC(=O)NCc1ccc(C(=O)O)cc1)CC2 |
| InChI | InChI=1S/C17H21N5O3/c1-2-14-20-15-8-7-13(10-22(15)21-14)19-17(25)18-9-11-3-5-12(6-4-11)16(23)24/h3-6,13H,2,7-10H2,1H3,(H,23,24)(H2,18,19,25) |
| InChIKey | RJBUKLMITVXRKV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |