3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid

C20H24N2O3 — CID 122005203

IUPAC3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid
SMILESCN(CCC(=O)O)C(=O)NCC(Cc1ccccc1)c1ccccc1
InChIInChI=1S/C20H24N2O3/c1-22(13-12-19(23)24)20(25)21-15-18(17-10-6-3-7-11-17)14-16-8-4-2-5-9-16/h2-11,18H,12-15H2,1H3,(H,21,25)(H,23,24)
InChIKeyOPXHCIKKYOXGTJ-UHFFFAOYSA-N
MW340.42 g/mol
LogP3.13
Rot. Bonds8

About 3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid

3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid (PubChem CID 122005203) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid.

Molecular Properties

Compound Name3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid
PubChem CID122005203
Molecular FormulaC20H24N2O3
Molecular Weight340.42 g/mol
Exact Mass340.18
IUPAC Name3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid
SMILESCN(CCC(=O)O)C(=O)NCC(Cc1ccccc1)c1ccccc1
InChIInChI=1S/C20H24N2O3/c1-22(13-12-19(23)24)20(25)21-15-18(17-10-6-3-7-11-17)14-16-8-4-2-5-9-16/h2-11,18H,12-15H2,1H3,(H,21,25)(H,23,24)
InChIKeyOPXHCIKKYOXGTJ-UHFFFAOYSA-N
XLogP3.13
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500340.42
LogP ≤ 53.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid?
The IUPAC name of 3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid (CID 122005203) is 3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid.
What is the SMILES notation for 3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid?
The canonical SMILES for 3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid is CN(CCC(=O)O)C(=O)NCC(Cc1ccccc1)c1ccccc1.
What is the InChIKey of 3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid?
The InChIKey is OPXHCIKKYOXGTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O3/c1-22(13-12-19(23)24)20(25)21-15-18(17-10-6-3-7-11-17)14-16-8-4-2-5-9-16/h2-11,18H,12-15H2,1H3,(H,21,25)(H,23,24).
What are the key properties of 3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid?
3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid has a molecular weight of 340.42 g/mol, XLogP of 3.13, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,3-diphenylpropylcarbamoyl(methyl)amino]propanoic acid is sourced from PubChem (CID 122005203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).