C16H22N2O3S — CID 122006136
1-[(4-methyl-2-methylsulfanylphenyl)methylcarbamoyl]piperidine-3-carboxylic acid (PubChem CID 122006136) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 1-[(4-methyl-2-methylsulfanylphenyl)methylcarbamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(4-methyl-2-methylsulfanylphenyl)methylcarbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122006136 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-[(4-methyl-2-methylsulfanylphenyl)methylcarbamoyl]piperidine-3-carboxylic acid |
| SMILES | CSc1cc(C)ccc1CNC(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C16H22N2O3S/c1-11-5-6-12(14(8-11)22-2)9-17-16(21)18-7-3-4-13(10-18)15(19)20/h5-6,8,13H,3-4,7,9-10H2,1-2H3,(H,17,21)(H,19,20) |
| InChIKey | AJBBORDQSJGGDV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |