C16H20ClN3O4 — CID 122006649
(3aS,6aR)-2-[2-[(5-chloro-2-pyridinyl)oxy]ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122006649) has the molecular formula C16H20ClN3O4 and a molecular weight of 353.81 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-[(5-chloro-2-pyridinyl)oxy]ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[2-[(5-chloro-2-pyridinyl)oxy]ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122006649 |
| Molecular Formula | C16H20ClN3O4 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (3aS,6aR)-2-[2-[(5-chloro-2-pyridinyl)oxy]ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(NCCOc1ccc(Cl)cn1)N1C[C@@H]2CCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C16H20ClN3O4/c17-12-3-4-13(19-8-12)24-7-6-18-15(23)20-9-11-2-1-5-16(11,10-20)14(21)22/h3-4,8,11H,1-2,5-7,9-10H2,(H,18,23)(H,21,22)/t11-,16+/m0/s1 |
| InChIKey | MHJLLAPXBDTVKU-MEDUHNTESA-N |
| XLogP | 2.01 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|