C13H17N3O5 — CID 122008086
3-[methyl-[2-(3-nitrophenyl)ethylcarbamoyl]amino]propanoic acid (PubChem CID 122008086) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is 3-[methyl-[2-(3-nitrophenyl)ethylcarbamoyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[2-(3-nitrophenyl)ethylcarbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122008086 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-[methyl-[2-(3-nitrophenyl)ethylcarbamoyl]amino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)NCCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H17N3O5/c1-15(8-6-12(17)18)13(19)14-7-5-10-3-2-4-11(9-10)16(20)21/h2-4,9H,5-8H2,1H3,(H,14,19)(H,17,18) |
| InChIKey | LQTAOQFEHVFREX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|