C18H26N2O3 — CID 122008259
4-[[(1S)-7-propan-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoylamino]butanoic acid (PubChem CID 122008259) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-[[(1S)-7-propan-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[(1S)-7-propan-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122008259 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 4-[[(1S)-7-propan-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoylamino]butanoic acid |
| SMILES | CC(C)c1ccc2c(c1)[C@@H](NC(=O)NCCCC(=O)O)CCC2 |
| InChI | InChI=1S/C18H26N2O3/c1-12(2)14-9-8-13-5-3-6-16(15(13)11-14)20-18(23)19-10-4-7-17(21)22/h8-9,11-12,16H,3-7,10H2,1-2H3,(H,21,22)(H2,19,20,23)/t16-/m0/s1 |
| InChIKey | BORQWKBYTWAONZ-INIZCTEOSA-N |
| XLogP | 3.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|