C18H32N2O3 — CID 122008436
4-[(2-cyclohexyl-2-methylpropyl)carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122008436) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is 4-[(2-cyclohexyl-2-methylpropyl)carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-cyclohexyl-2-methylpropyl)carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122008436 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | 4-[(2-cyclohexyl-2-methylpropyl)carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(CNC(=O)NC1CCC(C(=O)O)CC1)C1CCCCC1 |
| InChI | InChI=1S/C18H32N2O3/c1-18(2,14-6-4-3-5-7-14)12-19-17(23)20-15-10-8-13(9-11-15)16(21)22/h13-15H,3-12H2,1-2H3,(H,21,22)(H2,19,20,23) |
| InChIKey | SNSSLPNBNMEFIS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |