C15H21BrN2O4 — CID 122009749
4-[3-(4-bromo-2-methoxyphenyl)propylcarbamoylamino]butanoic acid (PubChem CID 122009749) has the molecular formula C15H21BrN2O4 and a molecular weight of 373.25 g/mol. Its IUPAC name is 4-[3-(4-bromo-2-methoxyphenyl)propylcarbamoylamino]butanoic acid.
| Compound Name | 4-[3-(4-bromo-2-methoxyphenyl)propylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122009749 |
| Molecular Formula | C15H21BrN2O4 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 4-[3-(4-bromo-2-methoxyphenyl)propylcarbamoylamino]butanoic acid |
| SMILES | COc1cc(Br)ccc1CCCNC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C15H21BrN2O4/c1-22-13-10-12(16)7-6-11(13)4-2-8-17-15(21)18-9-3-5-14(19)20/h6-7,10H,2-5,8-9H2,1H3,(H,19,20)(H2,17,18,21) |
| InChIKey | JVTSOLKISZLAQR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|