C17H23N3O4 — CID 122011714
4-[[[1-(ethylcarbamoyl)cyclobutyl]methylcarbamoylamino]methyl]benzoic acid (PubChem CID 122011714) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-[[[1-(ethylcarbamoyl)cyclobutyl]methylcarbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[[1-(ethylcarbamoyl)cyclobutyl]methylcarbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122011714 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 4-[[[1-(ethylcarbamoyl)cyclobutyl]methylcarbamoylamino]methyl]benzoic acid |
| SMILES | CCNC(=O)C1(CNC(=O)NCc2ccc(C(=O)O)cc2)CCC1 |
| InChI | InChI=1S/C17H23N3O4/c1-2-18-15(23)17(8-3-9-17)11-20-16(24)19-10-12-4-6-13(7-5-12)14(21)22/h4-7H,2-3,8-11H2,1H3,(H,18,23)(H,21,22)(H2,19,20,24) |
| InChIKey | YMUNZGSOZNDASG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |