C12H18F4N2O4 — CID 122011921
1-[2-(2,2,3,3-tetrafluoropropoxy)ethylcarbamoyl]piperidine-4-carboxylic acid (PubChem CID 122011921) has the molecular formula C12H18F4N2O4 and a molecular weight of 330.28 g/mol. Its IUPAC name is 1-[2-(2,2,3,3-tetrafluoropropoxy)ethylcarbamoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-(2,2,3,3-tetrafluoropropoxy)ethylcarbamoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 122011921 |
| Molecular Formula | C12H18F4N2O4 |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-[2-(2,2,3,3-tetrafluoropropoxy)ethylcarbamoyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)NCCOCC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C12H18F4N2O4/c13-10(14)12(15,16)7-22-6-3-17-11(21)18-4-1-8(2-5-18)9(19)20/h8,10H,1-7H2,(H,17,21)(H,19,20) |
| InChIKey | BTDURDHHPBQVSK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|