C14H15ClF2N2O3 — CID 122012352
1-[(4-chloro-2,5-difluorophenyl)methylcarbamoyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 122012352) has the molecular formula C14H15ClF2N2O3 and a molecular weight of 332.73 g/mol. Its IUPAC name is 1-[(4-chloro-2,5-difluorophenyl)methylcarbamoyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[(4-chloro-2,5-difluorophenyl)methylcarbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122012352 |
| Molecular Formula | C14H15ClF2N2O3 |
| Molecular Weight | 332.73 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 1-[(4-chloro-2,5-difluorophenyl)methylcarbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)NCc2cc(F)c(Cl)cc2F)C1 |
| InChI | InChI=1S/C14H15ClF2N2O3/c1-14(12(20)21)2-3-19(7-14)13(22)18-6-8-4-11(17)9(15)5-10(8)16/h4-5H,2-3,6-7H2,1H3,(H,18,22)(H,20,21) |
| InChIKey | IZKWHVHTNMWVJS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.73 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|