C18H19F3N2O3 — CID 122014019
(3S,4S)-1-(1-phenylpent-4-yn-2-ylcarbamoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 122014019) has the molecular formula C18H19F3N2O3 and a molecular weight of 368.36 g/mol. Its IUPAC name is (3S,4S)-1-(1-phenylpent-4-yn-2-ylcarbamoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-(1-phenylpent-4-yn-2-ylcarbamoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122014019 |
| Molecular Formula | C18H19F3N2O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (3S,4S)-1-(1-phenylpent-4-yn-2-ylcarbamoyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | C#CCC(Cc1ccccc1)NC(=O)N1C[C@@H](C(F)(F)F)[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C18H19F3N2O3/c1-2-6-13(9-12-7-4-3-5-8-12)22-17(26)23-10-14(16(24)25)15(11-23)18(19,20)21/h1,3-5,7-8,13-15H,6,9-11H2,(H,22,26)(H,24,25)/t13?,14-,15-/m1/s1 |
| InChIKey | VCQAFIPWUSRQSU-JVIGXAJISA-N |
| XLogP | 2.53 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|