C19H23N3O4 — CID 122015078
4-[(1-methyl-2-oxoquinolin-3-yl)methylcarbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122015078) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-[(1-methyl-2-oxoquinolin-3-yl)methylcarbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(1-methyl-2-oxoquinolin-3-yl)methylcarbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122015078 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-[(1-methyl-2-oxoquinolin-3-yl)methylcarbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | Cn1c(=O)c(CNC(=O)NC2CCC(C(=O)O)CC2)cc2ccccc21 |
| InChI | InChI=1S/C19H23N3O4/c1-22-16-5-3-2-4-13(16)10-14(17(22)23)11-20-19(26)21-15-8-6-12(7-9-15)18(24)25/h2-5,10,12,15H,6-9,11H2,1H3,(H,24,25)(H2,20,21,26) |
| InChIKey | YXSUXAYZHYSYGP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |