C20H26N2O3 — CID 122015915
(3aS,6aR)-2-[2-(2,3-dihydro-1H-inden-1-yl)ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122015915) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-(2,3-dihydro-1H-inden-1-yl)ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[2-(2,3-dihydro-1H-inden-1-yl)ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122015915 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (3aS,6aR)-2-[2-(2,3-dihydro-1H-inden-1-yl)ethylcarbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(NCCC1CCc2ccccc21)N1C[C@@H]2CCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C20H26N2O3/c23-18(24)20-10-3-5-16(20)12-22(13-20)19(25)21-11-9-15-8-7-14-4-1-2-6-17(14)15/h1-2,4,6,15-16H,3,5,7-13H2,(H,21,25)(H,23,24)/t15?,16-,20+/m0/s1 |
| InChIKey | MNFODCIQOVKHRY-XGNAPRINSA-N |
| XLogP | 3.00 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |