C17H23ClN2O3 — CID 122017052
3-[[3-(3-chlorophenyl)cyclopentyl]carbamoyl-methylamino]-2-methylpropanoic acid (PubChem CID 122017052) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is 3-[[3-(3-chlorophenyl)cyclopentyl]carbamoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[[3-(3-chlorophenyl)cyclopentyl]carbamoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122017052 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 3-[[3-(3-chlorophenyl)cyclopentyl]carbamoyl-methylamino]-2-methylpropanoic acid |
| SMILES | CC(CN(C)C(=O)NC1CCC(c2cccc(Cl)c2)C1)C(=O)O |
| InChI | InChI=1S/C17H23ClN2O3/c1-11(16(21)22)10-20(2)17(23)19-15-7-6-13(9-15)12-4-3-5-14(18)8-12/h3-5,8,11,13,15H,6-7,9-10H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | RKWPQJDINSHFKG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |