C16H23N3O5S — CID 122017256
1-[[3-(ethylsulfamoyl)phenyl]methylcarbamoyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 122017256) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is 1-[[3-(ethylsulfamoyl)phenyl]methylcarbamoyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[[3-(ethylsulfamoyl)phenyl]methylcarbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122017256 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-[[3-(ethylsulfamoyl)phenyl]methylcarbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CCNS(=O)(=O)c1cccc(CNC(=O)N2CCC(C)(C(=O)O)C2)c1 |
| InChI | InChI=1S/C16H23N3O5S/c1-3-18-25(23,24)13-6-4-5-12(9-13)10-17-15(22)19-8-7-16(2,11-19)14(20)21/h4-6,9,18H,3,7-8,10-11H2,1-2H3,(H,17,22)(H,20,21) |
| InChIKey | SWGAYQPNCQKXBA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |