C14H17Cl2N3O3 — CID 122017871
3-[[4-(2,6-dichlorophenyl)piperazine-1-carbonyl]amino]propanoic acid (PubChem CID 122017871) has the molecular formula C14H17Cl2N3O3 and a molecular weight of 346.21 g/mol. Its IUPAC name is 3-[[4-(2,6-dichlorophenyl)piperazine-1-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[4-(2,6-dichlorophenyl)piperazine-1-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122017871 |
| Molecular Formula | C14H17Cl2N3O3 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 3-[[4-(2,6-dichlorophenyl)piperazine-1-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)N1CCN(c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C14H17Cl2N3O3/c15-10-2-1-3-11(16)13(10)18-6-8-19(9-7-18)14(22)17-5-4-12(20)21/h1-3H,4-9H2,(H,17,22)(H,20,21) |
| InChIKey | WJJKUUNNJAUBCW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |